* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH623426 |
English Synonyms: | FCHGROUP FCH623426 |
MDL Number.: | MFCD16871379 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | c1c2c(n[nH]c1=O)CCS(=O)(=O)C2 |
InChi: | InChI=1S/C7H8N2O3S/c10-7-3-5-4-13(11,12)2-1-6(5)8-9-7/h3H,1-2,4H2,(H,9,10) |
InChiKey: | InChIKey=TYHWVGGIHGTUJR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.