* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-6298179 |
English Synonyms: | ABAMACHEM ABA-6298179 |
MDL Number.: | MFCD16871393 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | c1c2c(nnc1Cl)C3CCN2CC3 |
InChi: | InChI=1S/C9H10ClN3/c10-8-5-7-9(12-11-8)6-1-3-13(7)4-2-6/h5-6H,1-4H2 |
InChiKey: | InChIKey=HFBIHTCXOHFXSF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.