* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-(BUTAN-2-YL)PYRIDAZIN-3-AMINE |
| English Synonyms: | 6-(BUTAN-2-YL)PYRIDAZIN-3-AMINE |
| MDL Number.: | MFCD16871433 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CCC(C)c1ccc(nn1)N |
| InChi: | InChI=1S/C8H13N3/c1-3-6(2)7-4-5-8(9)11-10-7/h4-6H,3H2,1-2H3,(H2,9,11) |
| InChiKey: | InChIKey=HWNPWLPRQUWPNF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.