* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-(METHYLAMINO)PYRIDAZIN-3-OL |
| English Synonyms: | 6-(METHYLAMINO)PYRIDAZIN-3-OL |
| MDL Number.: | MFCD16871531 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | CNc1ccc(nn1)O |
| InChi: | InChI=1S/C5H7N3O/c1-6-4-2-3-5(9)8-7-4/h2-3H,1H3,(H,6,7)(H,8,9) |
| InChiKey: | InChIKey=YPAAPUGBTAYQMB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.