* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SELENA SEL11532358 |
English Synonyms: | SELENA SEL11532358 |
MDL Number.: | MFCD16871537 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CNc1cc2c(nn1)CCS(=O)(=O)C2 |
InChi: | InChI=1S/C8H11N3O2S/c1-9-8-4-6-5-14(12,13)3-2-7(6)10-11-8/h4H,2-3,5H2,1H3,(H,9,11) |
InChiKey: | InChIKey=TWXSUSJLLMPPLQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.