Molecular Structure:
CCD No.:CCD03251637
SELENA SEL11532323
Formula:C9 H13 N3 O2 S
MolWeight:227.287
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL11532323 |
| English Synonyms： | SELENA SEL11532323 |
| MDL Number.： | MFCD16871567 |
| H bond acceptor： | 5 |
| H bond donor： | 1 |
| Smile： | CCNc1cc2c(nn1)CCS(=O)(=O)C2 |
| InChi： | InChI=1S/C9H13N3O2S/c1-2-10-9-5-7-6-15(13,14)4-3-8(7)11-12-9/h5H,2-4,6H2,1H3,(H,10,12) |
| InChiKey： | InChIKey=LZPZHRLMPBFFBR-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
