* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-METHYL-N-PROPYL-5H,6H,7H,8H-PYRIDO[4,3-C]PYRIDAZIN-3-AMINE |
| English Synonyms: | 6-METHYL-N-PROPYL-5H,6H,7H,8H-PYRIDO[4,3-C]PYRIDAZIN-3-AMINE |
| MDL Number.: | MFCD16871576 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CCCNc1cc2c(nn1)CCN(C2)C |
| InChi: | InChI=1S/C11H18N4/c1-3-5-12-11-7-9-8-15(2)6-4-10(9)13-14-11/h7H,3-6,8H2,1-2H3,(H,12,14) |
| InChiKey: | InChIKey=CJIICKPGUDVDEE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.