* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-ETHYL-3-HYDRAZINYL-5H,6H,7H,8H-PYRIDO[4,3-C]PYRIDAZINE |
| English Synonyms: | 6-ETHYL-3-HYDRAZINYL-5H,6H,7H,8H-PYRIDO[4,3-C]PYRIDAZINE |
| MDL Number.: | MFCD16871616 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | CCN1CCc2c(cc(nn2)NN)C1 |
| InChi: | InChI=1S/C9H15N5/c1-2-14-4-3-8-7(6-14)5-9(11-10)13-12-8/h5H,2-4,6,10H2,1H3,(H,11,13) |
| InChiKey: | InChIKey=XYFHMIKVIWUBNU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.