* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FMOC AMINOTRIESTER |
| English Synonyms: | FMOC AMINOTRIESTER |
| MDL Number.: | MFCD16872073 |
| H bond acceptor: | 9 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)OC(=O)CCC(CCC(=O)OC(C)(C)C)(CCC(=O)OC(C)(C)C)NC(=O)OCC1c2ccccc2-c3c1cccc3 |
| InChi: | InChI=1S/C37H51NO8/c1-34(2,3)44-30(39)18-21-37(22-19-31(40)45-35(4,5)6,23-20-32(41)46-36(7,8)9)38-33(42)43-24-29-27-16-12-10-14-25(27)26-15-11-13-17-28(26)29/h10-17,29H,18-24H2,1-9H3,(H,38,42) |
| InChiKey: | InChIKey=KOMVMARGYJIIIC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.