* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-IODO-9H-PURINE HYDROIODIDE |
| English Synonyms: | 6-IODO-9H-PURINE HYDROIODIDE |
| MDL Number.: | MFCD16872297 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | c1[nH]c2c(n1)c(ncn2)I.I |
| InChi: | InChI=1S/C5H3IN4.HI/c6-4-3-5(9-1-7-3)10-2-8-4;/h1-2H,(H,7,8,9,10);1H |
| InChiKey: | InChIKey=XHLQVRSWVLXWJX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.