* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-CHLORO-9-ISOBUTYL-8-METHYL-9H-PURINE |
| CAS: | 302915-03-3 |
| English Synonyms: | 6-CHLORO-9-ISOBUTYL-8-METHYL-9H-PURINE |
| MDL Number.: | MFCD16872304 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | Cc1nc2c(n1CC(C)C)ncnc2Cl |
| InChi: | InChI=1S/C10H13ClN4/c1-6(2)4-15-7(3)14-8-9(11)12-5-13-10(8)15/h5-6H,4H2,1-3H3 |
| InChiKey: | InChIKey=OAEGDFQOZQCUSN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.