* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-CHLORO-9-ISOBUTYL-9H-PURINE |
CAS: | 195252-73-4 |
English Synonyms: | 6-CHLORO-9-ISOBUTYL-9H-PURINE |
MDL Number.: | MFCD16872307 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | CC(C)Cn1cnc2c1ncnc2Cl |
InChi: | InChI=1S/C9H11ClN4/c1-6(2)3-14-5-13-7-8(10)11-4-12-9(7)14/h4-6H,3H2,1-2H3 |
InChiKey: | InChIKey=JWYRNMHMJHCPIS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.