* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FCHGROUP FCH1348614 |
| English Synonyms: | FCHGROUP FCH1348614 |
| MDL Number.: | MFCD16872334 |
| H bond acceptor: | 7 |
| H bond donor: | 4 |
| Smile: | COCCNc1c([nH]c(=O)[nH]c1=O)N |
| InChi: | InChI=1S/C7H12N4O3/c1-14-3-2-9-4-5(8)10-7(13)11-6(4)12/h9H,2-3H2,1H3,(H4,8,10,11,12,13) |
| InChiKey: | InChIKey=MUQYKDWKGIHEGB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.