* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | QUINOXALINE-2,3,6-TRIOL |
| English Synonyms: | ZERENEX E/1070015 ; QUINOXALINE-2,3,6-TRIOL |
| MDL Number.: | MFCD16872339 |
| H bond acceptor: | 5 |
| H bond donor: | 3 |
| Smile: | c1cc2c(cc1O)nc(c(n2)O)O |
| InChi: | InChI=1S/C8H6N2O3/c11-4-1-2-5-6(3-4)10-8(13)7(12)9-5/h1-3,11H,(H,9,12)(H,10,13) |
| InChiKey: | InChIKey=ZPBGKVJFEYQZHZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.