* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-CHLORO-4A,12A-DIHYDROXY-4A,5,12,12A-TETRAHYDRO-1H-1,3,5,5A,11-PENTAAZA-NAPHTHACENE-2,4,6-TRIONE |
| English Synonyms: | 8-CHLORO-4A,12A-DIHYDROXY-4A,5,12,12A-TETRAHYDRO-1H-1,3,5,5A,11-PENTAAZA-NAPHTHACENE-2,4,6-TRIONE ; ZERENEX E/1070048 |
| MDL Number.: | MFCD16872350 |
| H bond acceptor: | 10 |
| H bond donor: | 5 |
| Smile: | c1cc2c(cc1Cl)c(=O)n3c(n2)CC4(C(N3)(C(=O)NC(=O)N4)O)O |
| InChi: | InChI=1S/C13H10ClN5O5/c14-5-1-2-7-6(3-5)9(20)19-8(15-7)4-12(23)13(24,18-19)10(21)16-11(22)17-12/h1-3,18,23-24H,4H2,(H2,16,17,21,22) |
| InChiKey: | InChIKey=UZMRRDFFGMXLKQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.