* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 7-METHYL-5-PHENYL-2H-[1,2,4]TRIAZOLO[4,3-C]PYRIMIDIN-3-ONE |
English Synonyms: | 7-METHYL-5-PHENYL-2H-[1,2,4]TRIAZOLO[4,3-C]PYRIMIDIN-3-ONE |
MDL Number.: | MFCD16872354 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | Cc1cc2n[nH]c(=O)n2c(n1)c3ccccc3 |
InChi: | InChI=1S/C12H10N4O/c1-8-7-10-14-15-12(17)16(10)11(13-8)9-5-3-2-4-6-9/h2-7H,1H3,(H,15,17) |
InChiKey: | InChIKey=YPAAEFDJGNCYAD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.