* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-PYRIDIN-3-YL-2H-[1,2,4]TRIAZOLO[4,3-C]PYRIMIDIN-3-ONE |
| English Synonyms: | 7-PYRIDIN-3-YL-2H-[1,2,4]TRIAZOLO[4,3-C]PYRIMIDIN-3-ONE |
| MDL Number.: | MFCD16872364 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | c1cc(cnc1)c2cc3n[nH]c(=O)n3cn2 |
| InChi: | InChI=1S/C10H7N5O/c16-10-14-13-9-4-8(12-6-15(9)10)7-2-1-3-11-5-7/h1-6H,(H,14,16) |
| InChiKey: | InChIKey=DNFUJRZYOFJZKS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.