* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-PROPYL-5-P-TOLYL-2H-[1,2,4]TRIAZOLO[4,3-C]PYRIMIDIN-3-ONE |
| English Synonyms: | 7-PROPYL-5-P-TOLYL-2H-[1,2,4]TRIAZOLO[4,3-C]PYRIMIDIN-3-ONE |
| MDL Number.: | MFCD16872377 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CCCc1cc2n[nH]c(=O)n2c(n1)c3ccc(cc3)C |
| InChi: | InChI=1S/C15H16N4O/c1-3-4-12-9-13-17-18-15(20)19(13)14(16-12)11-7-5-10(2)6-8-11/h5-9H,3-4H2,1-2H3,(H,18,20) |
| InChiKey: | InChIKey=JGYGZEYROIDKIN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.