* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 7-ETHYL-5-PYRAZIN-2-YL-2H-[1,2,4]TRIAZOLO[4,3-C]PYRIMIDIN-3-ONE |
English Synonyms: | 7-ETHYL-5-PYRAZIN-2-YL-2H-[1,2,4]TRIAZOLO[4,3-C]PYRIMIDIN-3-ONE |
MDL Number.: | MFCD16872408 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | CCc1cc2n[nH]c(=O)n2c(n1)c3cnccn3 |
InChi: | InChI=1S/C11H10N6O/c1-2-7-5-9-15-16-11(18)17(9)10(14-7)8-6-12-3-4-13-8/h3-6H,2H2,1H3,(H,16,18) |
InChiKey: | InChIKey=UDZLMAZZEBPFAL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.