* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-BENZYL-2-ETHYL-5,6,7,8-TETRAHYDRO-PYRIDO[4,3-D]PYRIMIDIN-4-OL |
| English Synonyms: | 6-BENZYL-2-ETHYL-5,6,7,8-TETRAHYDRO-PYRIDO[4,3-D]PYRIMIDIN-4-OL |
| MDL Number.: | MFCD16872934 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CCc1nc2c(c(n1)O)CN(CC2)Cc3ccccc3 |
| InChi: | InChI=1S/C16H19N3O/c1-2-15-17-14-8-9-19(11-13(14)16(20)18-15)10-12-6-4-3-5-7-12/h3-7H,2,8-11H2,1H3,(H,17,18,20) |
| InChiKey: | InChIKey=UFPCHNVGAMFNQC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.