* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX E/1100129 |
English Synonyms: | ZERENEX E/1100129 |
MDL Number.: | MFCD16873227 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | c1cc2c(cc1n3cnnc3)OCCO2 |
InChi: | InChI=1S/C10H9N3O2/c1-2-9-10(15-4-3-14-9)5-8(1)13-6-11-12-7-13/h1-2,5-7H,3-4H2 |
InChiKey: | InChIKey=HYWGYCKZCZVPDI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.