* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7,8,8-TRIMETHYL-4,5,6,7-TETRAHYDRO-2H-4,7-METHANOINDAZOL-2-AMINE |
| English Synonyms: | 7,8,8-TRIMETHYL-4,5,6,7-TETRAHYDRO-2H-4,7-METHANOINDAZOL-2-AMINE |
| MDL Number.: | MFCD16873997 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CC1([C@H]2CC[C@@]1(c3c2cn(n3)N)C)C |
| InChi: | InChI=1S/C11H17N3/c1-10(2)8-4-5-11(10,3)9-7(8)6-14(12)13-9/h6,8H,4-5,12H2,1-3H3/t8-,11+/m0/s1 |
| InChiKey: | InChIKey=LFAIZRNZPWRPPA-GZMMTYOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.