* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-(3-ETHYL-[1,2,4]OXADIAZOL-5-YL)-1H-INDOLE |
| CAS: | 1239766-37-0 |
| English Synonyms: | 3-ETHYL-5-(1H-INDOL-2-YL)-1,2,4-OXADIAZOLE ; 2-(3-ETHYL-[1,2,4]OXADIAZOL-5-YL)-1H-INDOLE |
| MDL Number.: | MFCD16874959 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CCc1nc(on1)c2cc3ccccc3[nH]2 |
| InChi: | InChI=1S/C12H11N3O/c1-2-11-14-12(16-15-11)10-7-8-5-3-4-6-9(8)13-10/h3-7,13H,2H2,1H3 |
| InChiKey: | InChIKey=WPTRIVIHJYOUIC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.