* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-(3-CYCLOPROPYL-[1,2,4]OXADIAZOL-5-YL)-2H-PYRIDAZIN-3-ONE |
| English Synonyms: | 6-(3-CYCLOPROPYL-[1,2,4]OXADIAZOL-5-YL)-2H-PYRIDAZIN-3-ONE |
| MDL Number.: | MFCD16875046 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | c1cc(=O)[nH]nc1c2nc(no2)C3CC3 |
| InChi: | InChI=1S/C9H8N4O2/c14-7-4-3-6(11-12-7)9-10-8(13-15-9)5-1-2-5/h3-5H,1-2H2,(H,12,14) |
| InChiKey: | InChIKey=GBQPEVIHZUEQCB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.