* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-(3-P-TOLYL-[1,2,4]OXADIAZOL-5-YL)-2H-PYRIDAZIN-3-ONE |
| English Synonyms: | 6-(3-P-TOLYL-[1,2,4]OXADIAZOL-5-YL)-2H-PYRIDAZIN-3-ONE |
| MDL Number.: | MFCD16875053 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | Cc1ccc(cc1)c2nc(on2)c3ccc(=O)[nH]n3 |
| InChi: | InChI=1S/C13H10N4O2/c1-8-2-4-9(5-3-8)12-14-13(19-17-12)10-6-7-11(18)16-15-10/h2-7H,1H3,(H,16,18) |
| InChiKey: | InChIKey=MTPYHQVKKJZHQX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.