* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5-(5-CHLORO-1H-INDOL-2-YL)-3-ETHYL-1,2,4-OXADIAZOLE |
CAS: | 1239749-09-7 |
English Synonyms: | 5-CHLORO-2-(3-ETHYL-[1,2,4]OXADIAZOL-5-YL)-1H-INDOLE ; 5-(5-CHLORO-1H-INDOL-2-YL)-3-ETHYL-1,2,4-OXADIAZOLE |
MDL Number.: | MFCD16875245 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCc1nc(on1)c2cc3cc(ccc3[nH]2)Cl |
InChi: | InChI=1S/C12H10ClN3O/c1-2-11-15-12(17-16-11)10-6-7-5-8(13)3-4-9(7)14-10/h3-6,14H,2H2,1H3 |
InChiKey: | InChIKey=BZDVKNBTYDSWRB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.