* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SB-277011-A HYDROCHLORIDE HYDRATE |
English Synonyms: | SB-277011-A HYDROCHLORIDE HYDRATE |
MDL Number.: | MFCD16875431 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | c1ccc2c(c1)c(ccn2)C(=O)N[C@@H]3CC[C@H](CC3)CCN4CCc5cc(ccc5C4)C#N.O.Cl |
InChi: | InChI=1S/C28H30N4O.ClH.H2O/c29-18-21-5-8-23-19-32(16-13-22(23)17-21)15-12-20-6-9-24(10-7-20)31-28(33)26-11-14-30-27-4-2-1-3-25(26)27;;/h1-5,8,11,14,17,20,24H,6-7,9-10,12-13,15-16,19H2,(H,31,33);1H;1H2/t20-,24-;; |
InChiKey: | InChIKey=OOWNBQACGIKNGM-ONAIBGCWSA-N |
Property |
|
Safety information |
|
WGK Germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.