* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | AEB-071 |
English Synonyms: | AEB-071 |
MDL Number.: | MFCD16875680 |
H bond acceptor: | 8 |
H bond donor: | 2 |
Smile: | CN1CCN(CC1)c2nc3ccccc3c(n2)C4=C(C(=O)NC4=O)c5c[nH]c6c5cccc6.Cl |
InChi: | InChI=1S/C25H22N6O2.ClH/c1-30-10-12-31(13-11-30)25-27-19-9-5-3-7-16(19)22(28-25)21-20(23(32)29-24(21)33)17-14-26-18-8-4-2-6-15(17)18;/h2-9,14,26H,10-13H2,1H3,(H,29,32,33);1H |
InChiKey: | InChIKey=ZDEDHGJNAAGSHW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.