* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZINC-70ZN L-ASPARTATE |
| English Synonyms: | ZINC-70ZN L-ASPARTATE |
| MDL Number.: | MFCD16875690 |
| H bond acceptor: | 10 |
| H bond donor: | 4 |
| Smile: | C([C@@H](C(=O)O)N)C(=O)O[72Zn]OC(=O)C[C@@H](C(=O)O)N |
| InChi: | InChI=1S/2C4H7NO4.Zn/c2*5-2(4(8)9)1-3(6)7;/h2*2H,1,5H2,(H,6,7)(H,8,9);/q;;+2/p-2/t2*2-;/m00./s1/i;;1+7 |
| InChiKey: | InChIKey=POEVDIARYKIEGF-NWPUYAGZSA-L |
|
|
| Comments: | ASSAY METHOD: CP MASS SHIFT: M+8 WGK: 3 |
| Information: | ISOTOPIC PURITY: 72 ATOM % 70ZN MW: 332.85 BY ATOM % CALCULATION |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.