* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1H-INDAZOLE-5,6-DIOL |
| CAS: | 98549-93-0 |
| English Synonyms: | 1H-INDAZOLE-5,6-DIOL ; 5,6-DIHYDROXY(1H)INDAZOLE |
| MDL Number.: | MFCD16875811 |
| H bond acceptor: | 4 |
| H bond donor: | 3 |
| Smile: | c1c2cn[nH]c2cc(c1O)O |
| InChi: | InChI=1S/C7H6N2O2/c10-6-1-4-3-8-9-5(4)2-7(6)11/h1-3,10-11H,(H,8,9) |
| InChiKey: | InChIKey=LDIOKVBESHXFQP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.