* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | AZ-628 |
CAS: | 1026601-22-8 |
English Synonyms: | AZ-628 |
MDL Number.: | MFCD16875937 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | Cc1ccc(cc1Nc2ccc3c(c2)c(=O)n(cn3)C)NC(=O)c4cccc(c4)C(C#N)C(C)C |
InChi: | InChI=1S/C28H27N5O2/c1-17(2)24(15-29)19-6-5-7-20(12-19)27(34)32-22-9-8-18(3)26(14-22)31-21-10-11-25-23(13-21)28(35)33(4)16-30-25/h5-14,16-17,24,31H,1-4H3,(H,32,34) |
InChiKey: | InChIKey=OKJQWRZHCAKUKI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.