* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RHODAMIN 6G IODIDE |
CAS: | 15505-26-7 |
English Synonyms: | RHODAMIN 6G IODIDE |
MDL Number.: | MFCD16876125 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | CCNc1cc2c(cc1C)c(c3cc(c(cc3[o+]2)NCC)C)c4ccccc4C(=O)OCC.[I-] |
InChi: | InChI=1S/C28H31N2O3.HI/c1-6-29-23-15-25-21(13-17(23)4)27(19-11-9-10-12-20(19)28(31)32-8-3)22-14-18(5)24(30-7-2)16-26(22)33-25;/h9-16,29-30H,6-8H2,1-5H3;1H/q+1;/p-1 |
InChiKey: | InChIKey=ONTOEFHWZIAHEQ-UHFFFAOYSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.