* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RHODAMIN 560 CHLORIDE |
English Synonyms: | RHODAMIN 560 CHLORIDE |
MDL Number.: | MFCD16876126 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | c1ccc(c(c1)c2c3ccc(cc3[o+]c4c2ccc(c4)N)N)C(=O)O.[Cl-] |
InChi: | InChI=1S/C20H14N2O3.ClH/c21-11-5-7-15-17(9-11)25-18-10-12(22)6-8-16(18)19(15)13-3-1-2-4-14(13)20(23)24;/h1-10H,21-22H2;1H |
InChiKey: | InChIKey=MYIOYATURDILJN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.