* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | DMT-DC(TAC) |
| English Synonyms: | DMT-DC(TAC) |
| MDL Number.: | MFCD16876145 |
| H bond acceptor: | 11 |
| H bond donor: | 2 |
| Smile: | CC(C)(C)c1ccc(cc1)OCC(=O)Nc2ccn(c(=O)n2)[C@H]3C[C@@H]([C@H](O3)COC(c4ccccc4)(c5ccc(cc5)OC)c6ccc(cc6)OC)O |
| InChi: | InChI=1S/C42H45N3O8/c1-41(2,3)28-11-21-34(22-12-28)51-27-38(47)43-37-23-24-45(40(48)44-37)39-25-35(46)36(53-39)26-52-42(29-9-7-6-8-10-29,30-13-17-32(49-4)18-14-30)31-15-19-33(50-5)20-16-31/h6-24,35-36,39,46H,25-27H2,1-5H3,(H,43,44,47,48)/t35-,36+,39+/m0/s1 |
| InChiKey: | InChIKey=VKBVJIVLVSSLLF-RETAKORUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.