* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | AGROCHELIN B |
English Synonyms: | AGROCHELIN B |
MDL Number.: | MFCD16876176 |
H bond acceptor: | 6 |
H bond donor: | 3 |
Smile: | CCCCCc1cccc(c1C2=N[C@H](CS2)[C@H]3N([C@@H](CS3)[C@H](C(C)(C)C(=O)O)O)C)O |
InChi: | InChI=1S/C23H34N2O4S2/c1-5-6-7-9-14-10-8-11-17(26)18(14)20-24-15(12-30-20)21-25(4)16(13-31-21)19(27)23(2,3)22(28)29/h8,10-11,15-16,19,21,26-27H,5-7,9,12-13H2,1-4H3,(H,28,29)/t15-,16+,19-,21+/m1/s1 |
InChiKey: | InChIKey=QZBCDLLHQSDFIG-ZEVBXJOLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.