* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | DEOXY-PHOMALONE |
| English Synonyms: | DEOXY-PHOMALONE |
| MDL Number.: | MFCD16876180 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | CCCC(=O)c1c(cc(c(c1O)CC)O)OC |
| InChi: | InChI=1S/C13H18O4/c1-4-6-9(14)12-11(17-3)7-10(15)8(5-2)13(12)16/h7,15-16H,4-6H2,1-3H3 |
| InChiKey: | InChIKey=GRQAKVFPDMDUIF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.