* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | LL-D-253A |
English Synonyms: | LL-D-253A |
MDL Number.: | MFCD16876183 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | C[C@@H]1CC(=O)c2c(cc(c(c2O1)CCO)O)OC |
InChi: | InChI=1S/C13H16O5/c1-7-5-10(16)12-11(17-2)6-9(15)8(3-4-14)13(12)18-7/h6-7,14-15H,3-5H2,1-2H3/t7-/m1/s1 |
InChiKey: | InChIKey=MFMBOHMTFYYVAI-SSDOTTSWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.