* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PREUSSOMERIN A |
| English Synonyms: | PREUSSOMERIN A |
| MDL Number.: | MFCD16876187 |
| H bond acceptor: | 7 |
| H bond donor: | 3 |
| Smile: | c1cc2c3c(c1)O[C@]45c6c(ccc(c6[C@H]([C@H]7[C@@H]4O7)O)O)O[C@@]3(O5)C=C[C@@H]2O |
| InChi: | InChI=1S/C20H14O7/c21-9-6-7-19-14-8(9)2-1-3-11(14)26-20(27-19)15-12(25-19)5-4-10(22)13(15)16(23)17-18(20)24-17/h1-7,9,16-18,21-23H/t9-,16+,17-,18-,19+,20-/m0/s1 |
| InChiKey: | InChIKey=YYUIJBSRPPKHNR-CWUFLABFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.