* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RASFONIN |
English Synonyms: | RASFONIN |
MDL Number.: | MFCD16876188 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | C/C=C(\C)/C[C@H](C)C[C@H](C)[C@@H]1[C@@H](C=CC(=O)O1)CC(=O)/C=C/C(=C/[C@H](CCO)CO)/C |
InChi: | InChI=1S/C26H40O5/c1-6-18(2)13-20(4)14-21(5)26-23(8-10-25(30)31-26)16-24(29)9-7-19(3)15-22(17-28)11-12-27/h6-10,15,20-23,26-28H,11-14,16-17H2,1-5H3/b9-7+,18-6+,19-15+/t20-,21-,22-,23-,26+/m0/s1 |
InChiKey: | InChIKey=QSOURIXQWGHRFW-LQCGFWQOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.