* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | X-14881B |
English Synonyms: | X-14881B |
MDL Number.: | MFCD16876189 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | C[C@@H]1CC2=C([C@@H]3[C@H](c4cccc(c4[C@@H]([C@]3(C=C2)O)O)OC)O)C(=O)C1 |
InChi: | InChI=1S/C20H22O5/c1-10-8-11-6-7-20(24)17(15(11)13(21)9-10)18(22)12-4-3-5-14(25-2)16(12)19(20)23/h3-7,10,17-19,22-24H,8-9H2,1-2H3/t10-,17-,18+,19+,20-/m1/s1 |
InChiKey: | InChIKey=KCAUKKHESDCTCZ-MHCXLAJTSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.