* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | XANTHOEPOCIN |
| English Synonyms: | XANTHOEPOCIN |
| MDL Number.: | MFCD16876190 |
| H bond acceptor: | 14 |
| H bond donor: | 4 |
| Smile: | Cc1cc2cc3c(c(c2c(=O)o1)O)C(C4(C(C3=O)(O4)OC)C56C(c7c(cc8cc(oc(=O)c8c7O)C)C(=O)C5(O6)OC)O)O |
| InChi: | InChI=1S/C30H22O14/c1-9-5-11-7-13-17(19(31)15(11)25(37)41-9)23(35)27(29(39-3,43-27)21(13)33)28-24(36)18-14(22(34)30(28,40-4)44-28)8-12-6-10(2)42-26(38)16(12)20(18)32/h5-8,23-24,31-32,35-36H,1-4H3 |
| InChiKey: | InChIKey=KJPAOKCLRDGPMI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.