* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | AG035029 |
CAS: | 669077-49-0 |
English Synonyms: | AG035029 |
MDL Number.: | MFCD16876281 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | Cc1c(nc(o1)c2ccccc2)CCOc3cccc4c3cnn4CCC(=O)O |
InChi: | InChI=1S/C22H21N3O4/c1-15-18(24-22(29-15)16-6-3-2-4-7-16)11-13-28-20-9-5-8-19-17(20)14-23-25(19)12-10-21(26)27/h2-9,14H,10-13H2,1H3,(H,26,27) |
InChiKey: | InChIKey=HZNZWQQPBJATLP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.