* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | HISPOLON |
English Synonyms: | HISPOLON |
MDL Number.: | MFCD16876372 |
H bond acceptor: | 4 |
H bond donor: | 3 |
Smile: | CC(=O)/C=C(/C=C/c1ccc(c(c1)O)O)\O |
InChi: | InChI=1S/C12H12O4/c1-8(13)6-10(14)4-2-9-3-5-11(15)12(16)7-9/h2-7,14-16H,1H3/b4-2+,10-6- |
InChiKey: | InChIKey=QDVIEIMMEUCFMW-QXYPORFMSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.