* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | N-GLYOXYLOYL-(2R)-BORNANE-10,2-SULTAM |
CAS: | 123191-45-7 |
English Synonyms: | N-GLYOXYLOYL-(2R)-BORNANE-10,2-SULTAM |
MDL Number.: | MFCD16876448 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | CC1([C@@H]2CC[C@]13CS(=O)(=O)N([C@@H]3C2)C(=O)C=O)C |
InChi: | InChI=1S/C12H17NO4S/c1-11(2)8-3-4-12(11)7-18(16,17)13(9(12)5-8)10(15)6-14/h6,8-9H,3-5,7H2,1-2H3/t8-,9-,12-/m1/s1 |
InChiKey: | InChIKey=KPVGXZHEAGPXCQ-KBVBSXBZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.