* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 9-[1-(TRIMETHYLSILYL)-2(E)-BUTENYL]-9-BORABICYCLO[3.3.1]NONANE |
| CAS: | 100701-75-5 |
| English Synonyms: | 9-[1-(TRIMETHYLSILYL)-2(E)-BUTENYL]-9-BORABICYCLO[3.3.1]NONANE |
| MDL Number.: | MFCD16876481 |
| H bond acceptor: | 0 |
| H bond donor: | 0 |
| Smile: | B1([C@@H]2CCC[C@H]1CCC2)C(/C=C/C)[Si](C)(C)C |
| InChi: | InChI=1S/C15H29BSi/c1-5-8-15(17(2,3)4)16-13-9-6-10-14(16)12-7-11-13/h5,8,13-15H,6-7,9-12H2,1-4H3/b8-5+/t13-,14+,15? |
| InChiKey: | InChIKey=CTEZPJQQPSDWEJ-QDHMSOTKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.