* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-BROMO-5-FLUORO-1-INDANE |
| English Synonyms: | 4-BROMO-6-FLUORO-2,3-DIHYDRO-1H-INDENE ; 7-BROMO-5-FLUORO-1-INDANE |
| MDL Number.: | MFCD16876795 |
| H bond acceptor: | 0 |
| H bond donor: | 0 |
| Smile: | c1c(cc(c2c1CCC2)Br)F |
| InChi: | InChI=1S/C9H8BrF/c10-9-5-7(11)4-6-2-1-3-8(6)9/h4-5H,1-3H2 |
| InChiKey: | InChIKey=KGXCCNOTVOBZIW-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.