* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-BROMO-6-FLUORO-2H-CHROMENE |
| English Synonyms: | 8-BROMO-6-FLUORO-2H-CHROMENE |
| MDL Number.: | MFCD16876860 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | c1c(cc(c2c1C=CCO2)Br)F |
| InChi: | InChI=1S/C9H6BrFO/c10-8-5-7(11)4-6-2-1-3-12-9(6)8/h1-2,4-5H,3H2 |
| InChiKey: | InChIKey=WTMSWLPATMMPQX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.