* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-PIPERAZIN-1-YL-1,3-DIHYDRO-INDOL-2-ONE |
| English Synonyms: | 7-PIPERAZIN-1-YL-1,3-DIHYDRO-INDOL-2-ONE |
| MDL Number.: | MFCD16876942 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | c1cc2c(c(c1)N3CCNCC3)NC(=O)C2 |
| InChi: | InChI=1S/C12H15N3O/c16-11-8-9-2-1-3-10(12(9)14-11)15-6-4-13-5-7-15/h1-3,13H,4-8H2,(H,14,16) |
| InChiKey: | InChIKey=HCOIFZUVHUSSMU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.