* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5,6,7-TRICHLOROISATIN |
CAS: | 1269468-62-3 |
English Synonyms: | 5,6,7-TRICHLORO-2,3-DIHYDRO-1H-INDOLE-2,3-DIONE ; 5,6,7-TRICHLOROISATIN |
MDL Number.: | MFCD16876979 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1c2c(c(c(c1Cl)Cl)Cl)NC(=O)C2=O |
InChi: | InChI=1S/C8H2Cl3NO2/c9-3-1-2-6(5(11)4(3)10)12-8(14)7(2)13/h1H,(H,12,13,14) |
InChiKey: | InChIKey=RUOVQLQFWQUUSL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.