* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-ISOPROPYL-1,3,4-OXADIAZOLE |
CAS: | 149324-24-3 |
English Synonyms: | 2-(PROPAN-2-YL)-1,3,4-OXADIAZOLE ; 2-(1-METHYLETHYL)-1,3,4-OXADIAZOLE ; 2-ISOPROPYL-1,3,4-OXADIAZOLE |
MDL Number.: | MFCD16877051 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | CC(C)c1nnco1 |
InChi: | InChI=1S/C5H8N2O/c1-4(2)5-7-6-3-8-5/h3-4H,1-2H3 |
InChiKey: | InChIKey=IYKCETRGBFKTRU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.